Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Chloro-2',4'-Dimethylbutyrophenone |
|---|---|
| Synonyms | 4-Chloro-2',4'-Dimethylbutyrophenone; Nsc163130 |
| Molecular Structure |  |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 210.70 |
| CAS Registry Number | 74298-65-0 |
| EINECS | 277-805-0 |
| SMILES | C1=C(C(=CC(=C1)C)C)C(=O)CCCCl |
| InChI | 1S/C12H15ClO/c1-9-5-6-11(10(2)8-9)12(14)4-3-7-13/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | JVJAFFIEOZLZBJ-UHFFFAOYSA-N |
| Density | 1.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.676°C at 760 mmHg (Cal.) |
| Flash point | 179.977°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2',4'-Dimethylbutyrophenone |