Online Database of Chemicals from Around the World
|
CAS#: 74305-98-9 Product: N'-(4-Bromophenyl)Butanehydrazide No suppilers available for the product. |
| Name | N'-(4-Bromophenyl)Butanehydrazide |
|---|---|
| Synonyms | N'-(4-Bromophenyl)Butyrohydrazide; Brn 5001683; Butyric Acid, 2-(P-Bromophenyl)Hydrazide |
| Molecular Structure |  |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.13 |
| CAS Registry Number | 74305-98-9 |
| SMILES | C1=C(C=CC(=C1)Br)NNC(CCC)=O |
| InChI | 1S/C10H13BrN2O/c1-2-3-10(14)13-12-9-6-4-8(11)5-7-9/h4-7,12H,2-3H2,1H3,(H,13,14) |
| InChIKey | STPHYKOKHWXZMH-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.888°C at 760 mmHg (Cal.) |
| Flash point | 134.563°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-(4-Bromophenyl)Butanehydrazide |