Online Database of Chemicals from Around the World
| Advanced Chemical Intermediates Ltd. | UK | Inquire | ||
|---|---|---|---|---|
 |
+44 (1840) 261-451 | |||
 |
enquiries@acints.com | |||
| Chemical manufacturer | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Amino-1,3-benzothiazole-6-carbonyl chloride |
|---|---|
| Synonyms | 2-aminobenzo[d]thiazole-6-carbonyl chloride; 2-aminobenzothiazole-6-carbonyl chloride; 2-Amino-benzothiazole-6-carbonyl chloride |
| Molecular Structure |  |
| Molecular Formula | C8H5ClN2OS |
| Molecular Weight | 212.66 |
| CAS Registry Number | 743384-25-0 |
| SMILES | c1cc2c(cc1C(=O)Cl)sc(n2)N |
| InChI | 1S/C8H5ClN2OS/c9-7(12)4-1-2-5-6(3-4)13-8(10)11-5/h1-3H,(H2,10,11) |
| InChIKey | OUFHCLJAQQOHIJ-UHFFFAOYSA-N |
| Density | 1.576g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.12°C at 760 mmHg (Cal.) |
| Flash point | 188.528°C (Cal.) |
| Refractive index | 1.751 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-1,3-benzothiazole-6-carbonyl chloride |