Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 5-Methyl-2-{[3-(trifluoromethyl)phenyl]amino}benzoic acid |
|---|---|
| Synonyms | 5-methyl-2-((3-(trifluoromethyl)phenyl)amino)benzoic acid |
| Molecular Structure | ![CAS#: 744149-01-7， 5-Methyl-2-{[3-(trifluoromethyl)phenyl]amino}benzoic acid](/moreStructures/744149-01-7.gif) |
| Molecular Formula | C15H12F3NO2 |
| Molecular Weight | 295.26 |
| CAS Registry Number | 744149-01-7 |
| SMILES | Cc1ccc(c(c1)C(=O)O)Nc2cccc(c2)C(F)(F)F |
| InChI | 1S/C15H12F3NO2/c1-9-5-6-13(12(7-9)14(20)21)19-11-4-2-3-10(8-11)15(16,17)18/h2-8,19H,1H3,(H,20,21) |
| InChIKey | RMIRMJNESSVQRM-UHFFFAOYSA-N |
| Density | 1.356g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.527°C at 760 mmHg (Cal.) |
| Flash point | 189.379°C (Cal.) |
| Refractive index | 1.579 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2-{[3-(trifluoromethyl)phenyl]amino}benzoic acid |