Online Database of Chemicals from Around the World
|
CAS#: 74417-13-3 Product: 5,6-Bis(3,4-Dichlorophenyl)-3-Methylsulfanyl-1,2,4-Triazine No suppilers available for the product. |
| Name | 5,6-Bis(3,4-Dichlorophenyl)-3-Methylsulfanyl-1,2,4-Triazine |
|---|---|
| Synonyms | 5,6-Bis(3,4-Dichlorophenyl)-3-(Methylthio)-1,2,4-Triazine; 5,6-Bis(3,4-Dichlorophenyl)-3-(Methylthio)-As-Triazine; As-Triazine, 5,6-Bis(3,4-Dichlorophenyl)-3-(Methylthio)- |
| Molecular Structure |  |
| Molecular Formula | C16H9Cl4N3S |
| Molecular Weight | 417.14 |
| CAS Registry Number | 74417-13-3 |
| SMILES | C1=C(C(=CC=C1C2=C(N=C(N=N2)SC)C3=CC=C(C(=C3)Cl)Cl)Cl)Cl |
| InChI | 1S/C16H9Cl4N3S/c1-24-16-21-14(8-2-4-10(17)12(19)6-8)15(22-23-16)9-3-5-11(18)13(20)7-9/h2-7H,1H3 |
| InChIKey | YILHLOPLXOOYMS-UHFFFAOYSA-N |
| Density | 1.592g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.465°C at 760 mmHg (Cal.) |
| Flash point | 289.735°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Bis(3,4-Dichlorophenyl)-3-Methylsulfanyl-1,2,4-Triazine |