Online Database of Chemicals from Around the World
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (919) 678-0702 | |||
 |
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | N-(4-Heptanyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| Synonyms | 1,3-BENZODIOXOLE-5-CARBOXAMIDE,N-(1-PROPYLBUTYL)-; N-(1-Propylbutyl)-1,3-benzodioxole-5-carboxamide |
| Molecular Structure |  |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.33 |
| CAS Registry Number | 745047-51-2 |
| SMILES | CCCC(CCC)NC(=O)c1ccc2OCOc2c1 |
| InChI | 1S/C15H21NO3/c1-3-5-12(6-4-2)16-15(17)11-7-8-13-14(9-11)19-10-18-13/h7-9,12H,3-6,10H2,1-2H3,(H,16,17) |
| InChIKey | YOBNUUGTIXQSPD-UHFFFAOYSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.037°C at 760 mmHg (Cal.) |
| Flash point | 183.035°C (Cal.) |
| Refractive index | 1.526 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Heptanyl)-1,3-benzodioxole-5-carboxamide |