|
CAS#: 74536-45-1 Product: Dimethyl 2,3-Diacetylbutanedioate No suppilers available for the product. |
| Name | Dimethyl 2,3-Diacetylbutanedioate |
|---|---|
| Synonyms | 2,3-Diacetylbutanedioic Acid Dimethyl Ester; 2,3-Diacetylsuccinic Acid Dimethyl Ester; Dimethyl 2,3-Diethanoylbutanedioate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 |
| CAS Registry Number | 74536-45-1 |
| EINECS | 277-914-3 |
| SMILES | CC(=O)C(C(C(OC)=O)C(=O)C)C(OC)=O |
| InChI | 1S/C10H14O6/c1-5(11)7(9(13)15-3)8(6(2)12)10(14)16-4/h7-8H,1-4H3 |
| InChIKey | MFUZXFWVYOMQBM-UHFFFAOYSA-N |
| Density | 1.177g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.664°C at 760 mmHg (Cal.) |
| Flash point | 146.97°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 2,3-Diacetylbutanedioate |