Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | cis-4-(2-Pyrazinyloxy)cyclohexanamine |
|---|---|
| Synonyms | (1s,4s)-4-(pyrazin-2-yloxy)cyclohexanamine |
| Molecular Structure |  |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 |
| CAS Registry Number | 746598-84-5 |
| SMILES | C1[C@@H](CC[C@@H](C1)OC2=NC=CN=C2)N |
| InChI | 1S/C10H15N3O/c11-8-1-3-9(4-2-8)14-10-7-12-5-6-13-10/h5-9H,1-4,11H2/t8-,9+ |
| InChIKey | RMVXHXGOICIBCO-DTORHVGOSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.4±42.0°C at 760 mmHg (Cal.) |
| Flash point | 137.9±27.9°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for cis-4-(2-Pyrazinyloxy)cyclohexanamine |