Online Database of Chemicals from Around the World
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (843)-884-4911 | |||
 |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 3,4-Diphenylisoxazole |
|---|---|
| Synonyms | 3,4-Di(Phenyl)Isoxazole; 3,4-Diphenylisoxazole; Isoxazole, 3,4-Diphenyl- |
| Molecular Structure |  |
| Molecular Formula | C15H11NO |
| Molecular Weight | 221.26 |
| CAS Registry Number | 7467-78-9 |
| SMILES | C1=CC=C(C=C1)C2=NOC=C2C3=CC=CC=C3 |
| InChI | 1S/C15H11NO/c1-3-7-12(8-4-1)14-11-17-16-15(14)13-9-5-2-6-10-13/h1-11H |
| InChIKey | UAVZKRLWYOSHHP-UHFFFAOYSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.247°C at 760 mmHg (Cal.) |
| Flash point | 126.753°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Diphenylisoxazole |