Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Chlorodiphenylacetic Acid |
|---|---|
| Synonyms | 2-Chloro-2,2-Di(Phenyl)Ethanoic Acid; Nci60_003739; Chloro(Diphenyl)Acetic Acid |
| Molecular Structure |  |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.69 |
| CAS Registry Number | 7475-56-1 |
| EINECS | 231-277-8 |
| SMILES | C2=C(C(C(O)=O)(Cl)C1=CC=CC=C1)C=CC=C2 |
| InChI | 1S/C14H11ClO2/c15-14(13(16)17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H,16,17) |
| InChIKey | UJRMHFPTLFNSTA-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.75°C at 760 mmHg (Cal.) |
| Flash point | 179.233°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chlorodiphenylacetic Acid |