|
CAS#: 7476-82-6 Product: Butyric Acid 2,3,4,6-Tetrachlorophenyl Ester No suppilers available for the product. |
| Name | Butyric Acid 2,3,4,6-Tetrachlorophenyl Ester |
|---|---|
| Synonyms | Butanoic Acid (2,3,4,6-Tetrachlorophenyl) Ester; Butyric Acid (2,3,4,6-Tetrachlorophenyl) Ester; Nsc404404 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8Cl4O2 |
| Molecular Weight | 301.98 |
| CAS Registry Number | 7476-82-6 |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Cl)OC(CCC)=O)Cl |
| InChI | 1S/C10H8Cl4O2/c1-2-3-7(15)16-10-6(12)4-5(11)8(13)9(10)14/h4H,2-3H2,1H3 |
| InChIKey | DZBDHMZJGXLTDK-UHFFFAOYSA-N |
| Density | 1.453g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.021°C at 760 mmHg (Cal.) |
| Flash point | 147.574°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butyric Acid 2,3,4,6-Tetrachlorophenyl Ester |