| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Dimethyl 1,4-naphthalenedicarboxylate |
|---|---|
| Synonyms | 1,4-Naphthalenedicarboxylic acid dimethyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.24 |
| CAS Registry Number | 7487-15-2 |
| SMILES | COC(=O)c1ccc(c2c1cccc2)C(=O)OC |
| InChI | 1S/C14H12O4/c1-17-13(15)11-7-8-12(14(16)18-2)10-6-4-3-5-9(10)11/h3-8H,1-2H3 |
| InChIKey | OCSXMIBZIHMVCP-UHFFFAOYSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.958°C at 760 mmHg (Cal.) |
| Flash point | 193.397°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | L.-H. Jing, D.-B. Qin, Z.-H. Mao, S.-J. Gu and H.-X. Zhang. Dimethyl naphthalene-1,4-dicarboxylate, Acta Cryst. (2005). E61, o4365-o4366 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dimethyl 1,4-naphthalenedicarboxylate |