Online Database of Chemicals from Around the World

2,4-Dichloro-5,7-dihydrothieno[3,4-D]pyrimidine
[CAS 74901-71-6]

List of Suppliers
Xi'an Tuochao Biotechnology Co., Ltd. China
www.xatuochao.cn
+86 18092957403
chen.zeshan@xatuochao.com
QQ Chat
Skype Chat
WeChat: +8618092957403
WhatsApp:+8618092957403
Chemical manufacturer since 2017
chemBlink Standard supplier since 2023

Identification
ClassificationPharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound
Name2,4-Dichloro-5,7-dihydrothieno[3,4-D]pyrimidine
Molecular Structure2,4-Dichloro-5,7-dihydrothieno[3,4-D]pyrimidine molecular structure (CAS 74901-71-6)
Molecular FormulaC6H4Cl2N2S
Molecular Weight207.08
CAS Registry Number74901-71-6
EC Number888-929-5
SMILESC1C2=C(CS1)N=C(N=C2Cl)Cl
Properties
Density1.6±0.1 g/cm3, Calc.*
Index of Refraction1.670, Calc.*
Boiling Point371.7±42.0 °C (760 mmHg), Calc.*
Flash Point178.6±27.9 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol symbol symbol symbol   GHS06;GHS07;GHS08;GHS09 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Specific target organ toxicity - single exposureSTOT SE3H335
Eye irritationEye Irrit.2AH319
Acute toxicityAcute Tox.4H302
Skin irritationSkin Irrit.2H315
SDSAvailable
up chemBlink Chemical Story
2,4-Dichloro-5,7-dihydrothieno[3,4-D]pyrimidine is a heterocyclic compound characterized by a fused pyrimidine and thiophene ring structure. This compound has gained attention in various fields due to its unique properties and potential applications, particularly in the realm of medicinal chemistry.

The discovery of 2,4-dichloro-5,7-dihydrothieno[3,4-D]pyrimidine can be traced back to research aimed at synthesizing new classes of bioactive compounds. The development of this compound is part of the ongoing exploration of thiophene-containing heterocycles, which have been recognized for their diverse biological activities. The structural features of 2,4-dichloro-5,7-dihydrothieno[3,4-D]pyrimidine contribute to its potential as a lead compound for drug development.

The compound's synthesis typically involves cyclization reactions of suitable precursors, leading to the formation of the thieno[3,4-D]pyrimidine framework. Various synthetic strategies have been developed to optimize yield and purity, reflecting the compound's importance in research.

One of the most significant applications of 2,4-dichloro-5,7-dihydrothieno[3,4-D]pyrimidine lies in its pharmacological properties. Research has shown that this compound exhibits various biological activities, including antimicrobial, antiviral, and anti-inflammatory effects. These attributes make it a candidate for further investigation as a potential therapeutic agent. In particular, its antiviral properties have been explored in the context of developing treatments for viral infections, as it may inhibit the replication of certain viruses.

Furthermore, studies have indicated that derivatives of 2,4-dichloro-5,7-dihydrothieno[3,4-D]pyrimidine may demonstrate selective inhibition of specific enzymes, such as kinases, which are crucial targets in cancer therapy. This suggests that modifications to its structure could lead to novel anticancer agents.

The compound has also been evaluated in the field of agrochemicals. Its potential as a pesticide or herbicide is of particular interest due to its ability to inhibit specific biological pathways in pests and weeds. This application is supported by its chemical stability and efficacy in various formulations, which are essential characteristics for agricultural use.

In addition to its medicinal and agricultural applications, 2,4-dichloro-5,7-dihydrothieno[3,4-D]pyrimidine serves as a valuable intermediate in organic synthesis. Its unique structure allows for further modifications, enabling the development of new compounds with tailored properties. Researchers are actively exploring its potential as a building block for creating complex molecular architectures that can be utilized in various chemical domains.

Ongoing research aims to deepen the understanding of the biological mechanisms underlying the activity of 2,4-dichloro-5,7-dihydrothieno[3,4-D]pyrimidine, with a focus on elucidating its interactions at the molecular level. Investigating its structure-activity relationships is essential for optimizing its efficacy and safety profile in potential therapeutic applications.

In summary, 2,4-dichloro-5,7-dihydrothieno[3,4-D]pyrimidine is a compound of significant interest due to its diverse biological activities and potential applications in medicine and agriculture. Its discovery reflects the broader effort to explore the pharmacological potential of thiophene-containing heterocycles, making it a promising candidate for future research and development.
Market Analysis Reports
Related Products
5,5-Dichloro-1,...  N-(5,6-Dichloro...  4,11-Dichloro-5...  3,10-Dichloro-5...  1,2-Dichloro-5,...  6,7-Dichloro-1,...  1,1-Dichloro-2,...  2,2-Dichloro-N-...  5,7-Dichloro-2,...  2,4-Dichloro-6,...  3,4-Dichloro-2,...  2,4-Dichloro-7,...  2,4-Dichloro-7,...  5,7-Dichloro-1,...  2,2-Dichloro-2'...  6,7-Dichloro-1,...  5,8-Dichloro-1,...  1,5-Dichloro-4,...  2,3-Dichloro-4,...  2,5-Dichloro-3,...