| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Chemical reagent >> Organic reagent >> Nitro compound |
|---|---|
| Name | 6-Nitrochrysene |
| Synonyms | 3-05-00-02383 (Beilstein Handbook Reference); 6-Nitrochrysene [Nitroarenes]; Brn 2134652 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H11NO2 |
| Molecular Weight | 273.29 |
| CAS Registry Number | 7496-02-8 |
| SMILES | C2=C([N+](=O)[O-])C1=CC=CC=C1C3=CC=C4C(=C23)C=CC=C4 |
| InChI | 1S/C18H11NO2/c20-19(21)18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H |
| InChIKey | UAWLTQJFZUYROA-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.003°C at 760 mmHg (Cal.) |
| Flash point | 252.485°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Auréa Andrade-Eiroa, Valérie Leroy and Philippe Dagaut. Advances in PAHs/nitro-PAHs fractioning, Anal. Methods, 2010, 2, 2017. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6-Nitrochrysene |