|
CAS#: 74980-11-3 Product: Diethyl acetamido[2-(bromomethyl)-5-nitrobenzyl]malonate No suppilers available for the product. |
| Name | Diethyl acetamido[2-(bromomethyl)-5-nitrobenzyl]malonate |
|---|---|
| Synonyms | Acétamido[2-(bromométhyl)-5-nitrobenzyl]malonate de diéthyle; Diethyl acetamido[2-(bromomethyl)-5-nitrobenzyl]malonate; Diethyl2- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21BrN2O7 |
| Molecular Weight | 445.26 |
| CAS Registry Number | 74980-11-3 |
| SMILES | CCOC(=O)C(Cc1cc(ccc1CBr)[N+](=O)[O-])(C(=O)OCC)NC(=O)C |
| InChI | 1S/C17H21BrN2O7/c1-4-26-15(22)17(19-11(3)21,16(23)27-5-2)9-13-8-14(20(24)25)7-6-12(13)10-18/h6-8H,4-5,9-10H2,1-3H3,(H,19,21) |
| InChIKey | VCCPQPAZFRNSGX-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 584.4±50.0°C at 760 mmHg (Cal.) |
| Flash point | 307.3±30.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl acetamido[2-(bromomethyl)-5-nitrobenzyl]malonate |