Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 2',3',4',6'-Tetramethoxyacetophenone |
|---|---|
| Synonyms | Nsc401465; 2,3,4,6-Tetramethoxy-Acetophenone |
| Molecular Structure |  |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 7508-05-6 |
| SMILES | C1=C(C(=C(C(=C1OC)OC)OC)C(C)=O)OC |
| InChI | 1S/C12H16O5/c1-7(13)10-8(14-2)6-9(15-3)11(16-4)12(10)17-5/h6H,1-5H3 |
| InChIKey | FENZKGOUICFKMZ-UHFFFAOYSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.259°C at 760 mmHg (Cal.) |
| Flash point | 158.072°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2',3',4',6'-Tetramethoxyacetophenone |