Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 4-(Chlorosulphonyl)Benzoyl Chloride |
|---|---|
| Synonyms | 4-(Chlorosulphonyl)Benzoyl Chloride |
| Molecular Structure |  |
| Molecular Formula | C7H4Cl2O3S |
| Molecular Weight | 239.07 |
| CAS Registry Number | 7516-60-1 |
| EINECS | 231-371-9 |
| SMILES | C1=CC(=CC=C1C(Cl)=O)[S](Cl)(=O)=O |
| InChI | 1S/C7H4Cl2O3S/c8-7(10)5-1-3-6(4-2-5)13(9,11)12/h1-4H |
| InChIKey | JYJUMAFOXPQPAU-UHFFFAOYSA-N |
| Density | 1.568g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.115°C at 760 mmHg (Cal.) |
| Flash point | 156.472°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Chlorosulphonyl)Benzoyl Chloride |