Online Database of Chemicals from Around the World
|
CAS#: 75162-60-6 Product: 2,4-Diacetylhematoporphyrin Dimethyl Ester No suppilers available for the product. |
| Name | 2,4-Diacetylhematoporphyrin Dimethyl Ester |
|---|---|
| Synonyms | Dahp-Dme |
| Molecular Structure |  |
| Molecular Formula | C40H46N4O8 |
| Molecular Weight | 710.83 |
| CAS Registry Number | 75162-60-6 |
| SMILES | C(C1=C(C3=NC1=CC5=NC(=CC2=C(C(=C([NH]2)C=C4[NH]C(=C3)C(=C4C)C(OC(=O)C)C)C(OC(=O)C)C)C)C(=C5CCC(OC)=O)C)C)CC(OC)=O |
| InChI | 1S/C40H46N4O8/c1-19-27(11-13-37(47)49-9)33-18-34-28(12-14-38(48)50-10)20(2)30(42-34)16-35-40(24(6)52-26(8)46)22(4)32(44-35)17-36-39(23(5)51-25(7)45)21(3)31(43-36)15-29(19)41-33/h15-18,23-24,43-44H,11-14H2,1-10H3 |
| InChIKey | CMPGXLXIGQGNTP-UHFFFAOYSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 1040.763°C at 760 mmHg (Cal.) |
| Flash point | 583.232°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diacetylhematoporphyrin Dimethyl Ester |