Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Amino-3,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| Synonyms | 2-amino-3,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylic acid |
| Molecular Structure | ![CAS#: 752193-64-9， 2-Amino-3,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylic acid](/moreStructures/752193-64-9.gif) |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 |
| CAS Registry Number | 752193-64-9 |
| SMILES | C1C2CC(C1C(C2O)(C(=O)O)N)O |
| InChI | 1S/C8H13NO4/c9-8(7(12)13)4-1-3(6(8)11)2-5(4)10/h3-6,10-11H,1-2,9H2,(H,12,13) |
| InChIKey | DXHGEDISXCJDCW-UHFFFAOYSA-N |
| Density | 1.594g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.739°C at 760 mmHg (Cal.) |
| Flash point | 217.327°C (Cal.) |
| Refractive index | 1.655 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-3,6-dihydroxybicyclo[2.2.1]heptane-2-carboxylic acid |