|
CAS#: 7522-44-3 Product: DL-2-Isobutylserine No suppilers available for the product. |
| Classification | Biochemical >> Amino acids and their derivatives >> Serine derivative |
|---|---|
| Name | DL-2-Isobutylserine |
| Synonyms | (2S)-2-Azaniumyl-2-(Hydroxymethyl)-4-Methyl-Pentanoate; (2S)-2-Ammonio-2-(Hydroxymethyl)-4-Methylpentanoate; (2S)-2-Ammonio-4-Methyl-2-Methylol-Valerate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 |
| CAS Registry Number | 7522-44-3 |
| SMILES | [C@@]([NH3+])(CC(C)C)(CO)C([O-])=O |
| InChI | 1S/C7H15NO3/c1-5(2)3-7(8,4-9)6(10)11/h5,9H,3-4,8H2,1-2H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | UKFHHTGBNYQWFD-ZETCQYMHSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.858°C at 760 mmHg (Cal.) |
| Flash point | 152.688°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for DL-2-Isobutylserine |