Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Methylbenzo[b]Thiophene-7-Carboxylic Acid |
|---|---|
| Synonyms | 2-Methylbenzothiophene-7-Carboxylic Acid; 2-Methyl-7-Benzothiophenecarboxylic Acid; Fs002074 |
| Molecular Structure | ![CAS#: 75288-80-1， 2-Methylbenzo[b]Thiophene-7-Carboxylic Acid](/moreStructures/75288-80-1.gif) |
| Molecular Formula | C10H8O2S |
| Molecular Weight | 192.23 |
| CAS Registry Number | 75288-80-1 |
| SMILES | C1=C(SC2=C1C=CC=C2C(=O)O)C |
| InChI | 1S/C10H8O2S/c1-6-5-7-3-2-4-8(10(11)12)9(7)13-6/h2-5H,1H3,(H,11,12) |
| InChIKey | IETMKXQKHOGTJS-UHFFFAOYSA-N |
| Density | 1.355g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.149°C at 760 mmHg (Cal.) |
| Flash point | 187.337°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylbenzo[b]Thiophene-7-Carboxylic Acid |