Online Database of Chemicals from Around the World
|
CAS#: 75413-99-9 Product: 8-Tert-Butyl-1,2,3,4-Tetrahydroquinoline No suppilers available for the product. |
| Name | 8-Tert-Butyl-1,2,3,4-Tetrahydroquinoline |
|---|---|
| Synonyms | 8-(Tert-Butyl)-1,2,3,4-Tetrahydroquinoline |
| Molecular Structure |  |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 |
| CAS Registry Number | 75413-99-9 |
| EINECS | 278-203-0 |
| SMILES | C2=C(C(C)(C)C)C1=C(CCCN1)C=C2 |
| InChI | 1S/C13H19N/c1-13(2,3)11-8-4-6-10-7-5-9-14-12(10)11/h4,6,8,14H,5,7,9H2,1-3H3 |
| InChIKey | FTAFKJQTGWHYTC-UHFFFAOYSA-N |
| Density | 0.951g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.787°C at 760 mmHg (Cal.) |
| Flash point | 127.556°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Tert-Butyl-1,2,3,4-Tetrahydroquinoline |