Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Nitro-2-pyrazinamine 1-oxide |
|---|---|
| Synonyms | 2-amino-3-nitropyrazine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C4H4N4O3 |
| Molecular Weight | 156.10 |
| CAS Registry Number | 754196-99-1 |
| SMILES | c1c[n+](c(c(n1)[N+](=O)[O-])N)[O-] |
| InChI | 1S/C4H4N4O3/c5-3-4(8(10)11)6-1-2-7(3)9/h1-2H,5H2 |
| InChIKey | FHSDZWFQEFXUFH-UHFFFAOYSA-N |
| Density | 1.875g/cm3 (Cal.) |
|---|---|
| Boiling point | 664.144°C at 760 mmHg (Cal.) |
| Flash point | 355.462°C (Cal.) |
| Refractive index | 1.748 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitro-2-pyrazinamine 1-oxide |