Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Tienocarbine |
|---|---|
| Synonyms | Tienocarbine [Inn]; Tienocarbino [Inn-Spanish]; Tienocarbinum [Inn-Latin] |
| Molecular Structure |  |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.36 |
| CAS Registry Number | 75458-65-0 |
| SMILES | C1=C4C(=C2C(=C1)SC=C2C)C3=C(CCN(C3)C)[NH]4 |
| InChI | 1S/C15H16N2S/c1-9-8-18-13-4-3-12-15(14(9)13)10-7-17(2)6-5-11(10)16-12/h3-4,8,16H,5-7H2,1-2H3 |
| InChIKey | GMIILPOVBUNJBY-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.3°C at 760 mmHg (Cal.) |
| Flash point | 220.691°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tienocarbine |