Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,3-Di(Benzyloxymethyl)-5-Fluorouracil |
|---|---|
| Synonyms | 5-Fluoro-1,3-Bis[(Phenylmethoxy)Methyl]- 2,4(1H,3H)-Pyrimidinedione; 1,3-Di(Benzyloxymethyl)-5-Fluorouracil |
| Molecular Structure |  |
| Molecular Formula | C20H19FN2O4 |
| Molecular Weight | 370.37 |
| CAS Registry Number | 75500-03-7 |
| SMILES | O=c1n(COCc2ccccc2)cc(c(=O)n1COCc1ccccc1)F |
| InChI | 1S/C20H19FN2O4/c21-18-11-22(14-26-12-16-7-3-1-4-8-16)20(25)23(19(18)24)15-27-13-17-9-5-2-6-10-17/h1-11H,12-15H2 |
| Market Analysis Reports |
| List of Reports Available for 1,3-Di(Benzyloxymethyl)-5-Fluorouracil |