|
CAS#: 75503-14-9 Product: 3,3,6,6-Tetramethylbicyclo[2.2.1]Heptane-2,5-Dithione No suppilers available for the product. |
| Name | 3,3,6,6-Tetramethylbicyclo[2.2.1]Heptane-2,5-Dithione |
|---|---|
| Synonyms | 3,3,6,6-Tetramethylnorbornane-2,5-Dithione; Bicyclo[2.2.1]Heptane-2,5-Dithione, 3,3,6,6-Tetramethyl-; Bicyclo(2.2.1)Heptane-2,5-Dithione, 3,3,6,6-Tetramethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16S2 |
| Molecular Weight | 212.37 |
| CAS Registry Number | 75503-14-9 |
| SMILES | CC1(C2C(=S)C(C(C1=S)C2)(C)C)C |
| InChI | 1S/C11H16S2/c1-10(2)6-5-7(8(10)12)11(3,4)9(6)13/h6-7H,5H2,1-4H3 |
| InChIKey | AJNZTOMPXGCAEM-UHFFFAOYSA-N |
| Density | 1.145g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.258°C at 760 mmHg (Cal.) |
| Flash point | 125.715°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,6,6-Tetramethylbicyclo[2.2.1]Heptane-2,5-Dithione |