Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-(Cyclopropylcarbonyl)benzamide |
|---|---|
| Synonyms | BENZAMIDE,N-(CYCLOPROPYLCARBONYL)-; N-(cyclopropanecarbonyl)benzamide |
| Molecular Structure |  |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 |
| CAS Registry Number | 756488-67-2 |
| SMILES | c1ccc(cc1)C(=O)NC(=O)C2CC2 |
| InChI | 1S/C11H11NO2/c13-10(8-4-2-1-3-5-8)12-11(14)9-6-7-9/h1-5,9H,6-7H2,(H,12,13,14) |
| InChIKey | KJIWWFBAXBQCRH-UHFFFAOYSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.146°C at 760 mmHg (Cal.) |
| Flash point | 157.765°C (Cal.) |
| Refractive index | 1.591 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Cyclopropylcarbonyl)benzamide |