Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1S,3R)-3-(Aminomethyl)-2,2-dimethylcyclobutanamine |
|---|---|
| Synonyms | (1S,3R)-3-(aminomethyl)-2,2-dimethylcyclobutanamine |
| Molecular Structure |  |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 |
| CAS Registry Number | 757139-71-2 |
| SMILES | CC1([C@@H](C[C@@H]1N)CN)C |
| InChI | 1S/C7H16N2/c1-7(2)5(4-8)3-6(7)9/h5-6H,3-4,8-9H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | NYPNUOOFRNXFCT-WDSKDSINSA-N |
| Density | 0.905g/cm3 (Cal.) |
|---|---|
| Boiling point | 175.168°C at 760 mmHg (Cal.) |
| Flash point | 67.637°C (Cal.) |
| Refractive index | 1.47 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,3R)-3-(Aminomethyl)-2,2-dimethylcyclobutanamine |