Online Database of Chemicals from Around the World
| Name | Trichloro(Phenylthio)-Silane |
|---|---|
| Synonyms | Trichloro-Phenylsulfanyl-Silane; Trichloro-(Phenylthio)Silane; Silane, Trichloro(Phenylthio)- |
| Molecular Structure |  |
| Molecular Formula | C6H5Cl3SSi |
| Molecular Weight | 243.61 |
| CAS Registry Number | 7579-91-1 |
| SMILES | C1=C(C=CC=C1)S[Si](Cl)(Cl)Cl |
| InChI | 1S/C6H5Cl3SSi/c7-11(8,9)10-6-4-2-1-3-5-6/h1-5H |
| InChIKey | XJANZXKEMOBQGL-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.3°C at 760 mmHg (Cal.) |
| Flash point | 100.34°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichloro(Phenylthio)-Silane |
