Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-tert-butylcyclopenta-1,3-diene-1-carboxamide |
|---|---|
| Synonyms | N-(tert-butyl)cyclopenta-1,3-dienecarboxamide |
| Molecular Structure |  |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.23 |
| CAS Registry Number | 757921-08-7 |
| SMILES | O=C(NC(C)(C)C)C=1C\C=C/C=1 |
| InChI | 1S/C10H15NO/c1-10(2,3)11-9(12)8-6-4-5-7-8/h4-6H,7H2,1-3H3,(H,11,12) |
| InChIKey | YQZFRXZVGNSQKP-UHFFFAOYSA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.373°C at 760 mmHg (Cal.) |
| Flash point | 188.52°C (Cal.) |
| Refractive index | 1.512 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-tert-butylcyclopenta-1,3-diene-1-carboxamide |