Online Database of Chemicals from Around the World
|
CAS#: 75795-05-0 Product: 2-Chloro-5-(4-Chloro-3,5-Difluorophenyl)-1,3-Difluorobenzene No suppilers available for the product. |
| Name | 2-Chloro-5-(4-Chloro-3,5-Difluorophenyl)-1,3-Difluorobenzene |
|---|---|
| Synonyms | 2-Chloro-5-(4-Chloro-3,5-Difluoro-Phenyl)-1,3-Difluoro-Benzene; 1,1'-Biphenyl, 4,4'-Dichloro-3,3',5,5'-Tetrafluoro-; 4,4'-Dichloro-3,3',5,5'-Tetrafluoro-1,1'-Biphenyl |
| Molecular Structure |  |
| Molecular Formula | C12H4Cl2F4 |
| Molecular Weight | 295.06 |
| CAS Registry Number | 75795-05-0 |
| SMILES | C1=C(C(=C(C=C1C2=CC(=C(C(=C2)F)Cl)F)F)Cl)F |
| InChI | 1S/C12H4Cl2F4/c13-11-7(15)1-5(2-8(11)16)6-3-9(17)12(14)10(18)4-6/h1-4H |
| InChIKey | KDISJAPCJLLXAX-UHFFFAOYSA-N |
| Density | 1.51g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.195°C at 760 mmHg (Cal.) |
| Flash point | 167.176°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-5-(4-Chloro-3,5-Difluorophenyl)-1,3-Difluorobenzene |