Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-Piperidin-1-Yl-Cyclohexanol |
|---|---|
| Synonyms | (1R,2R)-2-(1-Piperidyl)Cyclohexan-1-Ol; (1R,2R)-2-(1-Piperidyl)-1-Cyclohexanol; (1R,2R)-2-Piperidinocyclohexan-1-Ol |
| Molecular Structure |  |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 |
| CAS Registry Number | 7581-94-4 |
| EINECS | 231-485-9 |
| SMILES | [C@H]2(N1CCCCC1)[C@H](O)CCCC2 |
| InChI | 1S/C11H21NO/c13-11-7-3-2-6-10(11)12-8-4-1-5-9-12/h10-11,13H,1-9H2/t10-,11-/m1/s1 |
| InChIKey | UXCABTUQGBBPPF-GHMZBOCLSA-N |
| Density | 1.05g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.492°C at 760 mmHg (Cal.) |
| Flash point | 79.773°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Piperidin-1-Yl-Cyclohexanol |