Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,2,2-Trifluoro-1-[4-(methylamino)phenyl]ethanone |
|---|---|
| Synonyms | 2,2,2-trifluoro-1-(4-(methylamino)phenyl)ethanone |
| Molecular Structure | ![CAS#: 75822-12-7， 2,2,2-Trifluoro-1-[4-(methylamino)phenyl]ethanone](/moreStructures/75822-12-7.gif) |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16 |
| CAS Registry Number | 75822-12-7 |
| SMILES | CNc1ccc(cc1)C(=O)C(F)(F)F |
| InChI | 1S/C9H8F3NO/c1-13-7-4-2-6(3-5-7)8(14)9(10,11)12/h2-5,13H,1H3 |
| InChIKey | QVQFUGBRORKFLK-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 261.438°C at 760 mmHg (Cal.) |
| Flash point | 111.914°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trifluoro-1-[4-(methylamino)phenyl]ethanone |