Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Isopropyl-2-azabicyclo[2.1.1]hexane-1-carboxylic acid |
|---|---|
| Synonyms | 2-isopropyl-2-azabicyclo[2.1.1]hexane-1-carboxylic acid |
| Molecular Structure | ![CAS#: 758679-85-5， 2-Isopropyl-2-azabicyclo[2.1.1]hexane-1-carboxylic acid](/moreStructures/758679-85-5.gif) |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 |
| CAS Registry Number | 758679-85-5 |
| SMILES | O=C(O)C12N(C(C)C)CC(C1)C2 |
| InChI | 1S/C9H15NO2/c1-6(2)10-5-7-3-9(10,4-7)8(11)12/h6-7H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | ZJBIINNVGBJUTC-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.178°C at 760 mmHg (Cal.) |
| Flash point | 113.571°C (Cal.) |
| Refractive index | 1.561 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isopropyl-2-azabicyclo[2.1.1]hexane-1-carboxylic acid |