Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,2,3,3A,4,5,6,7,8,9,9A,10,11,12-Tetradecahydro-Perylene |
|---|---|
| Synonyms | Nsc112731; Perylene, 1,2,3,3A,4,5,6,7,8,9,9A,10,11,12-Tetradecahydro- |
| Molecular Structure |  |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 |
| CAS Registry Number | 7594-86-7 |
| SMILES | [C@H]24CCCC3=C1CCC[C@@H]5C1=C(C(=C23)CCC4)CCC5 |
| InChI | 1S/C20H26/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17/h13-14H,1-12H2/t13-,14+ |
| InChIKey | JAEIWHRMTMZKDG-OKILXGFUSA-N |
| Density | 1.081g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.006°C at 760 mmHg (Cal.) |
| Flash point | 195.774°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,3A,4,5,6,7,8,9,9A,10,11,12-Tetradecahydro-Perylene |