Online Database of Chemicals from Around the World
|
CAS#: 75965-75-2 Product: 8-Methoxy-2-Nitrobenzo[e][1]Benzoxole No suppilers available for the product. |
| Name | 8-Methoxy-2-Nitrobenzo[e][1]Benzoxole |
|---|---|
| Synonyms | 8-Methoxy-2-Nitro-Benzo[E]Benzofuran; 8-Methoxy-2-Nitrobenzo[E]Benzofuran; 8-Methoxy-2-Nitro-Benzo[E][1]Benzoxole |
| Molecular Structure | ![CAS#: 75965-75-2， 8-Methoxy-2-Nitrobenzo[e][1]Benzoxole](/moreStructures/75965-75-2.gif) |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.22 |
| CAS Registry Number | 75965-75-2 |
| SMILES | C1=CC3=C(C2=C1C=CC(=C2)OC)C=C(O3)[N+]([O-])=O |
| InChI | 1S/C13H9NO4/c1-17-9-4-2-8-3-5-12-11(10(8)6-9)7-13(18-12)14(15)16/h2-7H,1H3 |
| InChIKey | GUDGYQZVOAXJLS-UHFFFAOYSA-N |
| Density | 1.379g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.968°C at 760 mmHg (Cal.) |
| Flash point | 207.789°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Methoxy-2-Nitrobenzo[e][1]Benzoxole |