Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl (1S,2R,3R)-3-amino-2-hydroxycyclohexanecarboxylate |
|---|---|
| Synonyms | (1S,2R,3R)-ethyl 3-amino-2-hydroxycyclohexanecarboxylate |
| Molecular Structure |  |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 |
| CAS Registry Number | 760148-07-0 |
| SMILES | CCOC(=O)[C@H]1CCC[C@H]([C@@H]1O)N |
| InChI | 1S/C9H17NO3/c1-2-13-9(12)6-4-3-5-7(10)8(6)11/h6-8,11H,2-5,10H2,1H3/t6-,7+,8+/m0/s1 |
| InChIKey | ZJCSZZIFMAJTGZ-XLPZGREQSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.112°C at 760 mmHg (Cal.) |
| Flash point | 128.046°C (Cal.) |
| Refractive index | 1.498 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (1S,2R,3R)-3-amino-2-hydroxycyclohexanecarboxylate |