| Creative Peptides | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 624-4882 | |||
![]() |
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Arginine derivatives |
|---|---|
| Name | Fa-Ala-Arg-OH |
| Synonyms | (2S)-2-[[(2S)-2-[[(E)-3-(2-Furyl)Prop-2-Enoyl]Amino]Propanoyl]Amino]-5-Guanidino-Pentanoic Acid; (2S)-2-[[(2S)-2-[[(E)-3-(2-Furyl)-1-Oxoprop-2-Enyl]Amino]-1-Oxopropyl]Amino]-5-Guanidinopentanoic Acid; (2S)-2-[[(2S)-2-[[(E)-3-(2-Furyl)Acryloyl]Amino]Propanoyl]Amino]-5-Guanidino-Valeric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H23N5O5 |
| Molecular Weight | 365.39 |
| CAS Registry Number | 76079-06-6 |
| SMILES | [C@H](NC(=O)[C@@H](NC(=O)\C=C\C1=CC=CO1)C)(CCCN=C(N)N)C(O)=O |
| InChI | 1S/C16H23N5O5/c1-10(20-13(22)7-6-11-4-3-9-26-11)14(23)21-12(15(24)25)5-2-8-19-16(17)18/h3-4,6-7,9-10,12H,2,5,8H2,1H3,(H,20,22)(H,21,23)(H,24,25)(H4,17,18,19)/b7-6+/t10-,12-/m0/s1 |
| InChIKey | KVMXOYCJJRUPKZ-RIVSHMCHSA-N |
| Protein Sequence | FA-Ala-Arg-OH |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Fa-Ala-Arg-OH |