Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Methyl-2-propanyl 3,4-dihydroxybenzoate |
|---|---|
| Synonyms | BENZOIC ACID, 3,4-DIHYDROXY-, 1,1-DIMETHYLETHYL ESTER; tert-butyl 3,4-dihydroxybenzoate |
| Molecular Structure |  |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 760947-24-8 |
| SMILES | CC(C)(C)OC(=O)c1ccc(c(c1)O)O |
| InChI | 1S/C11H14O4/c1-11(2,3)15-10(14)7-4-5-8(12)9(13)6-7/h4-6,12-13H,1-3H3 |
| InChIKey | SKJCXMOGQFVKJJ-UHFFFAOYSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.773°C at 760 mmHg (Cal.) |
| Flash point | 140.189°C (Cal.) |
| Refractive index | 1.554 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl 3,4-dihydroxybenzoate |