Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Cyanonicotinoyl chloride 1-oxide |
|---|---|
| Synonyms | 5-(chlorocarbonyl)-2-cyanopyridine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C7H3ClN2O2 |
| Molecular Weight | 182.56 |
| CAS Registry Number | 760949-71-1 |
| SMILES | c1cc([n+](cc1C(=O)Cl)[O-])C#N |
| InChI | 1S/C7H3ClN2O2/c8-7(11)5-1-2-6(3-9)10(12)4-5/h1-2,4H |
| InChIKey | VWNXUNRPNBIZIM-UHFFFAOYSA-N |
| Density | 1.425g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.421°C at 760 mmHg (Cal.) |
| Flash point | 238.907°C (Cal.) |
| Refractive index | 1.61 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Cyanonicotinoyl chloride 1-oxide |