Online Database of Chemicals from Around the World
|
CAS#: 761-07-9 Product: (1,1,1-Trichloro-3-Nitro-Propan-2-Yl) Acetate No suppilers available for the product. |
| Name | (1,1,1-Trichloro-3-Nitro-Propan-2-Yl) Acetate |
|---|---|
| Synonyms | [2,2,2-Trichloro-1-(Nitromethyl)Ethyl] Acetate; Acetic Acid [2,2,2-Trichloro-1-(Nitromethyl)Ethyl] Ester; (1,1,1-Trichloro-3-Nitro-Propan-2-Yl) Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C5H6Cl3NO4 |
| Molecular Weight | 250.47 |
| CAS Registry Number | 761-07-9 |
| SMILES | C(C(C(Cl)(Cl)Cl)OC(C)=O)[N+](=O)[O-] |
| InChI | 1S/C5H6Cl3NO4/c1-3(10)13-4(2-9(11)12)5(6,7)8/h4H,2H2,1H3 |
| InChIKey | IZCQFYTXKWWSMP-UHFFFAOYSA-N |
| Density | 1.547g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.226°C at 760 mmHg (Cal.) |
| Flash point | 133.558°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1,1,1-Trichloro-3-Nitro-Propan-2-Yl) Acetate |