|
CAS#: 7613-16-3 Product: 1,8-Diaminooctane Dihydrochloride No suppilers available for the product. |
| Name | 1,8-Diaminooctane Dihydrochloride |
|---|---|
| Synonyms | 8-Azaniumyloctylammonium Dichloride; 8-Ammoniooctylammonium Dichloride; Octamethylenediamine Dihydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H22Cl2N2 |
| Molecular Weight | 217.18 |
| CAS Registry Number | 7613-16-3 |
| EINECS | 231-522-9 |
| SMILES | C(CCCC[NH3+])CCC[NH3+].[Cl-].[Cl-] |
| InChI | 1S/C8H20N2.2ClH/c9-7-5-3-1-2-4-6-8-10;;/h1-10H2;2*1H |
| InChIKey | ZFLWZOGXFQNIMT-UHFFFAOYSA-N |
| Boiling point | 240.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 165°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Diaminooctane Dihydrochloride |