| Name | 3,4-Dihydro-2,7,8-Trimethyl-2-(4,8,12-Trimethyltridecyl)-2H-Benzopyran-6-Ol |
|---|---|
| Synonyms | 2,7,8-Trimethyl-2-(4,8,12-Trimethyltridecyl)-6-Chromanol; Ls-826; 2H-1-Benzopyran-6-Ol, 3,4-Dihydro-2,7,8-Trimethyl-2-(4,8,12-Trimethyltridecyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 |
| CAS Registry Number | 7616-22-0 (1406-66-2) |
| EINECS | 231-523-4 |
| SMILES | C1=C(O)C(=C(C2=C1CCC(O2)(CCCC(CCCC(CCCC(C)C)C)C)C)C)C |
| InChI | 1S/C28H48O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h19-22,29H,8-18H2,1-7H3 |
| InChIKey | QUEDXNHFTDJVIY-UHFFFAOYSA-N |
| Density | 0.933g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.111°C at 760 mmHg (Cal.) |
| Flash point | 205.982°C (Cal.) |
| (1) | Abul K. Mallik, Hongdeng Qiu, Makoto Takafuji and Hirotaka Ihara. Strategic achievement for the baseline separation of tocopherol isomers by integration of weak interaction sites on alternating copolymer, Anal. Methods, 2011, 3, 1277. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydro-2,7,8-Trimethyl-2-(4,8,12-Trimethyltridecyl)-2H-Benzopyran-6-Ol |