Online Database of Chemicals from Around the World
|
CAS#: 76186-63-5 Product: N-(Acetyl-Methylamino)-N-Phenylnitrous Amide No suppilers available for the product. |
| Name | N-(Acetyl-Methylamino)-N-Phenylnitrous Amide |
|---|---|
| Synonyms | N-(Acetyl-Methyl-Amino)-N-Phenyl-Nitrous Amide; N-(Ethanoyl-Methyl-Amino)-N-Phenyl-Nitrous Amide; 1-Acetyl-1-Methyl-2-Nitroso-2-Phenylhydrazine |
| Molecular Structure |  |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.20 |
| CAS Registry Number | 76186-63-5 |
| SMILES | C1=C(N(N(C(=O)C)C)N=O)C=CC=C1 |
| InChI | 1S/C9H11N3O2/c1-8(13)11(2)12(10-14)9-6-4-3-5-7-9/h3-7H,1-2H3 |
| InChIKey | MFXMNSMTYUGIGR-UHFFFAOYSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.936°C at 760 mmHg (Cal.) |
| Flash point | 115.239°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Acetyl-Methylamino)-N-Phenylnitrous Amide |