Online Database of Chemicals from Around the World
|
CAS#: 76206-36-5 Product: Naphthalen-1-Yl N-Ethyl-N-Nitrosocarbamate No suppilers available for the product. |
| Name | Naphthalen-1-Yl N-Ethyl-N-Nitrosocarbamate |
|---|---|
| Synonyms | 1-Naphthyl N-Ethyl-N-Nitroso-Carbamate; N-Ethyl-N-Nitrosocarbamic Acid 1-Naphthyl Ester; N-Ethyl-N-Nitroso-Carbamic Acid 1-Naphthyl Ester |
| Molecular Structure |  |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 |
| CAS Registry Number | 76206-36-5 |
| SMILES | C1=CC=CC2=C1C(=CC=C2)OC(N(CC)N=O)=O |
| InChI | 1S/C13H12N2O3/c1-2-15(14-17)13(16)18-12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
| InChIKey | HLTSAAUNFXIGTA-UHFFFAOYSA-N |
| Density | 1.218g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.932°C at 760 mmHg (Cal.) |
| Flash point | 174.505°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naphthalen-1-Yl N-Ethyl-N-Nitrosocarbamate |