Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2S)-2-(Aminomethyl)cyclooctanol |
|---|---|
| Synonyms | (1R,2S)-2-(aminomethyl)cyclooctanol |
| Molecular Structure |  |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.25 |
| CAS Registry Number | 762184-93-0 |
| SMILES | C1CCC[C@H]([C@@H](CC1)CN)O |
| InChI | 1S/C9H19NO/c10-7-8-5-3-1-2-4-6-9(8)11/h8-9,11H,1-7,10H2/t8-,9+/m0/s1 |
| InChIKey | NTZFMGQNHBKVNN-DTWKUNHWSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.359°C at 760 mmHg (Cal.) |
| Flash point | 114.89°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-2-(Aminomethyl)cyclooctanol |