Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Fluzinamide |
|---|---|
| Synonyms | N-Methyl-3-[3-(Trifluoromethyl)Phenoxy]-1-Azetidinecarboxamide; Fluzinamide; D04239 |
| Molecular Structure |  |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 |
| CAS Registry Number | 76263-13-3 |
| SMILES | C2=C(OC1CN(C(NC)=O)C1)C=CC=C2C(F)(F)F |
| InChI | 1S/C12H13F3N2O2/c1-16-11(18)17-6-10(7-17)19-9-4-2-3-8(5-9)12(13,14)15/h2-5,10H,6-7H2,1H3,(H,16,18) |
| InChIKey | YULWJRNIKFFGNU-UHFFFAOYSA-N |
| Density | 1.337g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.717°C at 760 mmHg (Cal.) |
| Flash point | 205.218°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fluzinamide |