|
CAS#: 76293-13-5 Product: 2,4-Dimethylthioxanthen-9-One No suppilers available for the product. |
| Name | 2,4-Dimethylthioxanthen-9-One |
|---|---|
| Synonyms | 2,4-Dimethyl-9-Thioxanthenone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12OS |
| Molecular Weight | 240.32 |
| CAS Registry Number | 76293-13-5 |
| EINECS | 278-414-8 |
| SMILES | C1=C(C=C(C2=C1C(=O)C3=C(S2)C=CC=C3)C)C |
| InChI | 1S/C15H12OS/c1-9-7-10(2)15-12(8-9)14(16)11-5-3-4-6-13(11)17-15/h3-8H,1-2H3 |
| InChIKey | LCHAFMWSFCONOO-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.017°C at 760 mmHg (Cal.) |
| Flash point | 229.763°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethylthioxanthen-9-One |