| Abacipharm Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (410) 417-5545 | |||
![]() |
sales@abacipharm.com | |||
| Chemical manufacturer | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-4-Pyridinylalanine |
|---|---|
| Synonyms | (S)-2-(pyridin-4-ylamino)propanoic acid; 4-Pyridinylalanine; 4-pyridyl alanine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 |
| CAS Registry Number | 76478-27-8 |
| SMILES | C[C@@H](C(=O)O)NC1=CC=NC=C1 |
| InChI | 1S/C8H10N2O2/c1-6(8(11)12)10-7-2-4-9-5-3-7/h2-6H,1H3,(H,9,10)(H,11,12)/t6-/m0/s1 |
| InChIKey | SAAQPSNNIOGFSQ-LURJTMIESA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.4±22.0°C at 760 mmHg (Cal.) |
| Flash point | 190.5±22.3°C (Cal.) |
| (1) | Shouxin Liu, Yihua Yang, Xiaoli Zhen, Junzhang Li, Huimin He, Juan Feng and Andrew Whiting. Enhanced reduction of C–N multiple bonds using sodium borohydride and an amorphous nickel catalyst, Org. Biomol. Chem., 2012, 10, 663. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-4-Pyridinylalanine |