Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl 1-[(trimethylsilyl)amino]cyclopropanecarboxylate |
|---|---|
| Synonyms | ethyl 1-((trimethylsilyl)amino)cyclopropanecarboxylate |
| Molecular Structure | ![CAS#: 765242-60-2， Ethyl 1-[(trimethylsilyl)amino]cyclopropanecarboxylate](/moreStructures/765242-60-2.gif) |
| Molecular Formula | C9H19NO2Si |
| Molecular Weight | 201.34 |
| CAS Registry Number | 765242-60-2 |
| SMILES | CCOC(=O)C1(CC1)N[Si](C)(C)C |
| InChI | 1S/C9H19NO2Si/c1-5-12-8(11)9(6-7-9)10-13(2,3)4/h10H,5-7H2,1-4H3 |
| InChIKey | GUCLXEJJBTWWHO-UHFFFAOYSA-N |
| Density | 0.977g/cm3 (Cal.) |
|---|---|
| Boiling point | 198.304°C at 760 mmHg (Cal.) |
| Flash point | 73.732°C (Cal.) |
| Refractive index | 1.455 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 1-[(trimethylsilyl)amino]cyclopropanecarboxylate |